C21H27F5O3 — CID 91354057
(8R,9S,10R,14S,17S)-17-hydroxy-13-(3,3,4,4,4-pentafluorobutan-2-yl)-1,2,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,4-dione (PubChem CID 91354057) has the molecular formula C21H27F5O3 and a molecular weight of 422.43 g/mol. Its IUPAC name is (8R,9S,10R,14S,17S)-17-hydroxy-13-(3,3,4,4,4-pentafluorobutan-2-yl)-1,2,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,4-dione.
| Compound Name | (8R,9S,10R,14S,17S)-17-hydroxy-13-(3,3,4,4,4-pentafluorobutan-2-yl)-1,2,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,4-dione |
|---|---|
| PubChem CID | 91354057 |
| Molecular Formula | C21H27F5O3 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (8R,9S,10R,14S,17S)-17-hydroxy-13-(3,3,4,4,4-pentafluorobutan-2-yl)-1,2,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,4-dione |
| SMILES | CC(C12CC[C@H]3[C@@H](CCC4C(=O)C(=O)CC[C@@H]43)[C@@H]1CC[C@@H]2O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H27F5O3/c1-10(20(22,23)21(24,25)26)19-9-8-12-11-4-6-16(27)18(29)14(11)3-2-13(12)15(19)5-7-17(19)28/h10-15,17,28H,2-9H2,1H3/t10?,11-,12-,13-,14?,15+,17+,19?/m1/s1 |
| InChIKey | UXRBJBDRBVUCPR-XCHBLJTKSA-N |
| XLogP | 4.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|