C26H43O3Si — CID 86602195
CID 86602195 (PubChem CID 86602195) has the molecular formula C26H43O3Si and a molecular weight of 431.71 g/mol.
| Compound Name | CID 86602195 |
|---|---|
| PubChem CID | 86602195 |
| Molecular Formula | C26H43O3Si |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | — |
| SMILES | CC(C)C(C)(C)C1=C2CC[C@@H]3[C@H](CC[C@]4(CO[Si](C)C)[C@@H](O)CC[C@@H]34)[C@H]2CCC1=O |
| InChI | InChI=1S/C26H43O3Si/c1-16(2)25(3,4)24-20-8-7-19-18(17(20)9-11-22(24)27)13-14-26(15-29-30(5)6)21(19)10-12-23(26)28/h16-19,21,23,28H,7-15H2,1-6H3/t17-,18-,19-,21+,23+,26-/m1/s1 |
| InChIKey | WGGYBXUYMWRSDF-FVLCMFLHSA-N |
| XLogP | 5.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|