C15H22O2 — CID 13084352
(3R,3aR)-3-hydroxy-3a,6-dimethyl-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one (PubChem CID 13084352) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3R,3aR)-3-hydroxy-3a,6-dimethyl-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one.
| Compound Name | (3R,3aR)-3-hydroxy-3a,6-dimethyl-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 13084352 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3R,3aR)-3-hydroxy-3a,6-dimethyl-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
| SMILES | CC1=C2CC[C@]3(C)C(CC[C@H]3O)C2CCC1=O |
| InChI | InChI=1S/C15H22O2/c1-9-10-7-8-15(2)12(4-6-14(15)17)11(10)3-5-13(9)16/h11-12,14,17H,3-8H2,1-2H3/t11?,12?,14-,15-/m1/s1 |
| InChIKey | DCEFUYKVMXITER-BBNOBNGHSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |