C17H25FO2 — CID 142402791
[(1S)-1-(3a,6-dimethyl-7-oxo-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl)ethyl] hypofluorite (PubChem CID 142402791) has the molecular formula C17H25FO2 and a molecular weight of 280.38 g/mol. Its IUPAC name is [(1S)-1-(3a,6-dimethyl-7-oxo-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl)ethyl] hypofluorite.
| Compound Name | [(1S)-1-(3a,6-dimethyl-7-oxo-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl)ethyl] hypofluorite |
|---|---|
| PubChem CID | 142402791 |
| Molecular Formula | C17H25FO2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [(1S)-1-(3a,6-dimethyl-7-oxo-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl)ethyl] hypofluorite |
| SMILES | CC1=C2CCC3(C)C(CCC3[C@H](C)OF)C2CCC1=O |
| InChI | InChI=1S/C17H25FO2/c1-10-12-8-9-17(3)14(11(2)20-18)5-6-15(17)13(12)4-7-16(10)19/h11,13-15H,4-9H2,1-3H3/t11-,13?,14?,15?,17?/m0/s1 |
| InChIKey | LRHFNLPDCCYFRB-AOYIQCRGSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |