C29H42N4O4 — CID 125031289
N-[(E)-[(3S,3aR,9aS,9bS)-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-ylidene]amino]-2,4-dinitroaniline (PubChem CID 125031289) has the molecular formula C29H42N4O4 and a molecular weight of 510.68 g/mol. Its IUPAC name is N-[(E)-[(3S,3aR,9aS,9bS)-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-ylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[(3S,3aR,9aS,9bS)-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-ylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 125031289 |
| Molecular Formula | C29H42N4O4 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | N-[(E)-[(3S,3aR,9aS,9bS)-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-ylidene]amino]-2,4-dinitroaniline |
| SMILES | CC1=C2CC[C@]3(C)[C@H]([C@H](C)CCCC(C)C)CC[C@H]3[C@@H]2CC/C1=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H42N4O4/c1-18(2)7-6-8-19(3)24-11-12-25-23-10-14-26(20(4)22(23)15-16-29(24,25)5)30-31-27-13-9-21(32(34)35)17-28(27)33(36)37/h9,13,17-19,23-25,31H,6-8,10-12,14-16H2,1-5H3/b30-26+/t19-,23-,24+,25+,29-/m1/s1 |
| InChIKey | NIBJHZMALCCDHM-CZYXXREUSA-N |
| XLogP | 8.29 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|