C24H34O5 — CID 22800270
[(3S,8S,9S,13S,14S,17S)-17-[(1S)-1-acetyloxyethyl]-13-methyl-6-oxo-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 22800270) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(3S,8S,9S,13S,14S,17S)-17-[(1S)-1-acetyloxyethyl]-13-methyl-6-oxo-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,13S,14S,17S)-17-[(1S)-1-acetyloxyethyl]-13-methyl-6-oxo-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 22800270 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(3S,8S,9S,13S,14S,17S)-17-[(1S)-1-acetyloxyethyl]-13-methyl-6-oxo-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2=C(C1)C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H34O5/c1-13(28-14(2)25)21-7-8-22-19-12-23(27)20-11-16(29-15(3)26)5-6-17(20)18(19)9-10-24(21,22)4/h13,16,18-19,21-22H,5-12H2,1-4H3/t13-,16-,18+,19+,21+,22-,24+/m0/s1 |
| InChIKey | OKFFIQZDTJGBED-DAQLKRBHSA-N |
| XLogP | 4.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |