C25H37IO7 — CID 10897129
[(1S,4R)-4-[(1S,3aS,4S,5S,7aS)-1-[(1S)-1-acetyloxyethyl]-4-(iodomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-(formyloxymethyl)-3-oxocyclohexyl] acetate (PubChem CID 10897129) has the molecular formula C25H37IO7 and a molecular weight of 576.47 g/mol. Its IUPAC name is [(1S,4R)-4-[(1S,3aS,4S,5S,7aS)-1-[(1S)-1-acetyloxyethyl]-4-(iodomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-(formyloxymethyl)-3-oxocyclohexyl] acetate.
| Compound Name | [(1S,4R)-4-[(1S,3aS,4S,5S,7aS)-1-[(1S)-1-acetyloxyethyl]-4-(iodomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-(formyloxymethyl)-3-oxocyclohexyl] acetate |
|---|---|
| PubChem CID | 10897129 |
| Molecular Formula | C25H37IO7 |
| Molecular Weight | 576.47 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | [(1S,4R)-4-[(1S,3aS,4S,5S,7aS)-1-[(1S)-1-acetyloxyethyl]-4-(iodomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-(formyloxymethyl)-3-oxocyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@](COC=O)([C@H]2CC[C@]3(C)[C@@H]([C@H](C)OC(C)=O)CC[C@H]3[C@@H]2CI)C(=O)C1 |
| InChI | InChI=1S/C25H37IO7/c1-15(32-16(2)28)20-5-6-21-19(12-26)22(8-9-24(20,21)4)25(13-31-14-27)10-7-18(11-23(25)30)33-17(3)29/h14-15,18-22H,5-13H2,1-4H3/t15-,18-,19-,20+,21-,22-,24+,25-/m0/s1 |
| InChIKey | CHSNJSYCNOPFCE-HVUJHLGXSA-N |
| XLogP | 4.28 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|