C26H40O8 — CID 10719525
[(1S,3aS,3bS,5aS,7S,9aR,9bS,11aS)-1-(1-acetyloxyethyl)-9a-(formyloxymethyl)-5a-methoxy-11a-methyl-2,3,3a,3b,4,6,7,8,9,9b,10,11-dodecahydro-1H-indeno[4,5-c]chromen-7-yl] acetate (PubChem CID 10719525) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is [(1S,3aS,3bS,5aS,7S,9aR,9bS,11aS)-1-(1-acetyloxyethyl)-9a-(formyloxymethyl)-5a-methoxy-11a-methyl-2,3,3a,3b,4,6,7,8,9,9b,10,11-dodecahydro-1H-indeno[4,5-c]chromen-7-yl] acetate.
| Compound Name | [(1S,3aS,3bS,5aS,7S,9aR,9bS,11aS)-1-(1-acetyloxyethyl)-9a-(formyloxymethyl)-5a-methoxy-11a-methyl-2,3,3a,3b,4,6,7,8,9,9b,10,11-dodecahydro-1H-indeno[4,5-c]chromen-7-yl] acetate |
|---|---|
| PubChem CID | 10719525 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [(1S,3aS,3bS,5aS,7S,9aR,9bS,11aS)-1-(1-acetyloxyethyl)-9a-(formyloxymethyl)-5a-methoxy-11a-methyl-2,3,3a,3b,4,6,7,8,9,9b,10,11-dodecahydro-1H-indeno[4,5-c]chromen-7-yl] acetate |
| SMILES | CO[C@]12C[C@@H](OC(C)=O)CC[C@]1(COC=O)[C@H]1CC[C@]3(C)[C@@H](C(C)OC(C)=O)CC[C@H]3[C@@H]1CO2 |
| InChI | InChI=1S/C26H40O8/c1-16(33-17(2)28)21-6-7-22-20-13-32-26(30-5)12-19(34-18(3)29)8-11-25(26,14-31-15-27)23(20)9-10-24(21,22)4/h15-16,19-23H,6-14H2,1-5H3/t16?,19-,20-,21+,22-,23-,24+,25-,26-/m0/s1 |
| InChIKey | HNBKVKGUVBHVMF-LMXQKYQNSA-N |
| XLogP | 3.64 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|