C24H37NO5 — CID 101442386
[(3S,3aS,5aS,5bR,8S,9aS,10Z,10aR,10bS)-3-[(1R)-1-acetyloxyethyl]-10-hydroxyimino-3a,5b-dimethyl-2,3,4,5,5a,6,7,8,9,9a,10a,10b-dodecahydro-1H-cyclopenta[a]fluoren-8-yl] acetate (PubChem CID 101442386) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is [(3S,3aS,5aS,5bR,8S,9aS,10Z,10aR,10bS)-3-[(1R)-1-acetyloxyethyl]-10-hydroxyimino-3a,5b-dimethyl-2,3,4,5,5a,6,7,8,9,9a,10a,10b-dodecahydro-1H-cyclopenta[a]fluoren-8-yl] acetate.
| Compound Name | [(3S,3aS,5aS,5bR,8S,9aS,10Z,10aR,10bS)-3-[(1R)-1-acetyloxyethyl]-10-hydroxyimino-3a,5b-dimethyl-2,3,4,5,5a,6,7,8,9,9a,10a,10b-dodecahydro-1H-cyclopenta[a]fluoren-8-yl] acetate |
|---|---|
| PubChem CID | 101442386 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | [(3S,3aS,5aS,5bR,8S,9aS,10Z,10aR,10bS)-3-[(1R)-1-acetyloxyethyl]-10-hydroxyimino-3a,5b-dimethyl-2,3,4,5,5a,6,7,8,9,9a,10a,10b-dodecahydro-1H-cyclopenta[a]fluoren-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@H](C1)/C(=N\O)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@@H](C)OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H37NO5/c1-13(29-14(2)26)17-6-7-18-21-19(9-11-23(17,18)4)24(5)10-8-16(30-15(3)27)12-20(24)22(21)25-28/h13,16-21,28H,6-12H2,1-5H3/b25-22+/t13-,16+,17-,18+,19+,20-,21+,23-,24-/m1/s1 |
| InChIKey | XXHCNWAEDIVQCE-UREVAJGXSA-N |
| XLogP | 4.58 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|