C19H28O2 — CID 102131510
(3R,4aS,6aR,6bS,11aS,11bS)-3-hydroxy-10,11b-dimethyl-2,3,4,4a,5,6,6a,6b,7,8,11,11a-dodecahydro-1H-benzo[a]fluoren-9-one (PubChem CID 102131510) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3R,4aS,6aR,6bS,11aS,11bS)-3-hydroxy-10,11b-dimethyl-2,3,4,4a,5,6,6a,6b,7,8,11,11a-dodecahydro-1H-benzo[a]fluoren-9-one.
| Compound Name | (3R,4aS,6aR,6bS,11aS,11bS)-3-hydroxy-10,11b-dimethyl-2,3,4,4a,5,6,6a,6b,7,8,11,11a-dodecahydro-1H-benzo[a]fluoren-9-one |
|---|---|
| PubChem CID | 102131510 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (3R,4aS,6aR,6bS,11aS,11bS)-3-hydroxy-10,11b-dimethyl-2,3,4,4a,5,6,6a,6b,7,8,11,11a-dodecahydro-1H-benzo[a]fluoren-9-one |
| SMILES | CC1=C2C[C@H]3[C@@H](CC[C@H]4C[C@H](O)CC[C@@]43C)[C@@H]2CCC1=O |
| InChI | InChI=1S/C19H28O2/c1-11-16-10-17-15(14(16)5-6-18(11)21)4-3-12-9-13(20)7-8-19(12,17)2/h12-15,17,20H,3-10H2,1-2H3/t12-,13+,14-,15-,17-,19-/m0/s1 |
| InChIKey | ZEQCUONNFMPUHK-SOAYJNKUSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |