C17H26O — CID 102070786
(4aS,4bS,8aR)-1,7,7,8a-tetramethyl-3,4,4a,4b,5,6,8,9-octahydrofluoren-2-one (PubChem CID 102070786) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (4aS,4bS,8aR)-1,7,7,8a-tetramethyl-3,4,4a,4b,5,6,8,9-octahydrofluoren-2-one.
| Compound Name | (4aS,4bS,8aR)-1,7,7,8a-tetramethyl-3,4,4a,4b,5,6,8,9-octahydrofluoren-2-one |
|---|---|
| PubChem CID | 102070786 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (4aS,4bS,8aR)-1,7,7,8a-tetramethyl-3,4,4a,4b,5,6,8,9-octahydrofluoren-2-one |
| SMILES | CC1=C2C[C@@]3(C)CC(C)(C)CC[C@H]3[C@@H]2CCC1=O |
| InChI | InChI=1S/C17H26O/c1-11-13-9-17(4)10-16(2,3)8-7-14(17)12(13)5-6-15(11)18/h12,14H,5-10H2,1-4H3/t12-,14+,17+/m1/s1 |
| InChIKey | VQRGOYVQGDWFDR-IFIJOSMWSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |