C16H24O — CID 162825637
(1S,3aE,8R,9aS)-1,4-dimethyl-8-prop-1-en-2-yl-1,2,3,6,7,8,9,9a-octahydrocyclopenta[8]annulen-5-one (PubChem CID 162825637) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (1S,3aE,8R,9aS)-1,4-dimethyl-8-prop-1-en-2-yl-1,2,3,6,7,8,9,9a-octahydrocyclopenta[8]annulen-5-one.
| Compound Name | (1S,3aE,8R,9aS)-1,4-dimethyl-8-prop-1-en-2-yl-1,2,3,6,7,8,9,9a-octahydrocyclopenta[8]annulen-5-one |
|---|---|
| PubChem CID | 162825637 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (1S,3aE,8R,9aS)-1,4-dimethyl-8-prop-1-en-2-yl-1,2,3,6,7,8,9,9a-octahydrocyclopenta[8]annulen-5-one |
| SMILES | C=C(C)[C@@H]1CCC(=O)/C(C)=C2/CC[C@H](C)[C@@H]2C1 |
| InChI | InChI=1S/C16H24O/c1-10(2)13-6-8-16(17)12(4)14-7-5-11(3)15(14)9-13/h11,13,15H,1,5-9H2,2-4H3/b14-12-/t11-,13+,15-/m0/s1 |
| InChIKey | AXHSUILLDJSUJT-ZSWQVXJQSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|