C13H20O — CID 92982551
(4R)-2,4-dimethyl-3-(3-methylbut-3-enyl)cyclohex-2-en-1-one (PubChem CID 92982551) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (4R)-2,4-dimethyl-3-(3-methylbut-3-enyl)cyclohex-2-en-1-one.
| Compound Name | (4R)-2,4-dimethyl-3-(3-methylbut-3-enyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 92982551 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (4R)-2,4-dimethyl-3-(3-methylbut-3-enyl)cyclohex-2-en-1-one |
| SMILES | C=C(C)CCC1=C(C)C(=O)CC[C@H]1C |
| InChI | InChI=1S/C13H20O/c1-9(2)5-7-12-10(3)6-8-13(14)11(12)4/h10H,1,5-8H2,2-4H3/t10-/m1/s1 |
| InChIKey | ZYRXKVPVJVHWET-SNVBAGLBSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|