C16H22O — CID 3462936
1,8a-dimethyl-3,4,4a,4b,5,6,7,8-octahydrophenanthren-2-one (PubChem CID 3462936) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 1,8a-dimethyl-3,4,4a,4b,5,6,7,8-octahydrophenanthren-2-one.
| Compound Name | 1,8a-dimethyl-3,4,4a,4b,5,6,7,8-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 3462936 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1,8a-dimethyl-3,4,4a,4b,5,6,7,8-octahydrophenanthren-2-one |
| SMILES | CC1=C2C=CC3(C)CCCCC3C2CCC1=O |
| InChI | InChI=1S/C16H22O/c1-11-12-8-10-16(2)9-4-3-5-14(16)13(12)6-7-15(11)17/h8,10,13-14H,3-7,9H2,1-2H3 |
| InChIKey | OVAFVKYBXXPAID-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |