C16H20O — CID 134841145
(4aS,8aS)-1,8a-dimethyl-3,4,4a,4b,5,8-hexahydrophenanthren-2-one (PubChem CID 134841145) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is (4aS,8aS)-1,8a-dimethyl-3,4,4a,4b,5,8-hexahydrophenanthren-2-one.
| Compound Name | (4aS,8aS)-1,8a-dimethyl-3,4,4a,4b,5,8-hexahydrophenanthren-2-one |
|---|---|
| PubChem CID | 134841145 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (4aS,8aS)-1,8a-dimethyl-3,4,4a,4b,5,8-hexahydrophenanthren-2-one |
| SMILES | CC1=C2C=C[C@]3(C)CC=CCC3[C@@H]2CCC1=O |
| InChI | InChI=1S/C16H20O/c1-11-12-8-10-16(2)9-4-3-5-14(16)13(12)6-7-15(11)17/h3-4,8,10,13-14H,5-7,9H2,1-2H3/t13-,14?,16+/m1/s1 |
| InChIKey | KJKLWQBYKSSPBX-XIFZVWCKSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|