C15H18O — CID 99951193
(4aR,4bS,8aS)-8a-methyl-3,4,4a,4b,5,8-hexahydrophenanthren-2-one (PubChem CID 99951193) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (4aR,4bS,8aS)-8a-methyl-3,4,4a,4b,5,8-hexahydrophenanthren-2-one.
| Compound Name | (4aR,4bS,8aS)-8a-methyl-3,4,4a,4b,5,8-hexahydrophenanthren-2-one |
|---|---|
| PubChem CID | 99951193 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (4aR,4bS,8aS)-8a-methyl-3,4,4a,4b,5,8-hexahydrophenanthren-2-one |
| SMILES | C[C@]12C=CC3=CC(=O)CC[C@@H]3[C@@H]1CC=CC2 |
| InChI | InChI=1S/C15H18O/c1-15-8-3-2-4-14(15)13-6-5-12(16)10-11(13)7-9-15/h2-3,7,9-10,13-14H,4-6,8H2,1H3/t13-,14-,15-/m0/s1 |
| InChIKey | FXOUFKCTHRODGA-KKUMJFAQSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|