C19H28O4 — CID 57008061
(8R,9R,10S,13S,14S)-17-hydroxy-10-(hydroxymethyl)-13-methyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,4-dione (PubChem CID 57008061) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-hydroxy-10-(hydroxymethyl)-13-methyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,4-dione.
| Compound Name | (8R,9R,10S,13S,14S)-17-hydroxy-10-(hydroxymethyl)-13-methyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,4-dione |
|---|---|
| PubChem CID | 57008061 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-hydroxy-10-(hydroxymethyl)-13-methyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,4-dione |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CCC4C(=O)C(=O)CC[C@@]43CO)[C@@H]1CCC2O |
| InChI | InChI=1S/C19H28O4/c1-18-8-6-13-11(12(18)4-5-16(18)22)2-3-14-17(23)15(21)7-9-19(13,14)10-20/h11-14,16,20,22H,2-10H2,1H3/t11-,12-,13+,14?,16?,18-,19-/m0/s1 |
| InChIKey | LVRJCOZVRHTFJC-SGXJOUCWSA-N |
| XLogP | 2.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|