C18H22F2O2 — CID 154329064
(8R,9S,13R,14S)-13-(difluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 154329064) has the molecular formula C18H22F2O2 and a molecular weight of 308.37 g/mol. Its IUPAC name is (8R,9S,13R,14S)-13-(difluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13R,14S)-13-(difluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 154329064 |
| Molecular Formula | C18H22F2O2 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (8R,9S,13R,14S)-13-(difluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C(F)F)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C18H22F2O2/c19-17(20)18-8-7-13-12-4-2-11(21)9-10(12)1-3-14(13)15(18)5-6-16(18)22/h2,4,9,13-17,21-22H,1,3,5-8H2/t13-,14-,15+,16?,18-/m1/s1 |
| InChIKey | CHNTWOCBUFROKJ-WMMRIRDVSA-N |
| XLogP | 3.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |