C26H33FO — CID 92840778
[(3aR,3bS,5aS,6R,8aR,8bS)-1,3a,5a-trimethyl-2,3,3b,4,5,6,7,8,8a,8b,9,10-dodecahydroindeno[5,4-e]inden-6-yl]-(4-fluorophenyl)methanone (PubChem CID 92840778) has the molecular formula C26H33FO and a molecular weight of 380.55 g/mol. Its IUPAC name is [(3aR,3bS,5aS,6R,8aR,8bS)-1,3a,5a-trimethyl-2,3,3b,4,5,6,7,8,8a,8b,9,10-dodecahydroindeno[5,4-e]inden-6-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(3aR,3bS,5aS,6R,8aR,8bS)-1,3a,5a-trimethyl-2,3,3b,4,5,6,7,8,8a,8b,9,10-dodecahydroindeno[5,4-e]inden-6-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 92840778 |
| Molecular Formula | C26H33FO |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | [(3aR,3bS,5aS,6R,8aR,8bS)-1,3a,5a-trimethyl-2,3,3b,4,5,6,7,8,8a,8b,9,10-dodecahydroindeno[5,4-e]inden-6-yl]-(4-fluorophenyl)methanone |
| SMILES | CC1=C2CC[C@H]3[C@H]4CC[C@@H](C(=O)c5ccc(F)cc5)[C@@]4(C)CC[C@@H]3[C@@]2(C)CC1 |
| InChI | InChI=1S/C26H33FO/c1-16-12-14-25(2)20(16)9-8-19-21-10-11-23(26(21,3)15-13-22(19)25)24(28)17-4-6-18(27)7-5-17/h4-7,19,21-23H,8-15H2,1-3H3/t19-,21+,22-,23-,25-,26-/m0/s1 |
| InChIKey | WNGRBEAUTJGOIR-FNLBEDGWSA-N |
| XLogP | 6.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|