C25H34O3 — CID 59202724
CID 59202724 (PubChem CID 59202724) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol.
| Compound Name | CID 59202724 |
|---|---|
| PubChem CID | 59202724 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC(=O)C3(CC=CC3)C1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C25H34O3/c1-22-12-9-21(26)24(10-3-4-11-24)20(22)6-5-17-18(22)7-13-23(2)19(17)8-14-25(23)27-15-16-28-25/h3-4,6,17-19H,5,7-16H2,1-2H3/t17-,18+,19+,22-,23+/m1/s1 |
| InChIKey | ZDNPRMHWRXIFGJ-JOWRDOSLSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|