C26H31NO3 — CID 118650146
CID 118650146 (PubChem CID 118650146) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol.
| Compound Name | CID 118650146 |
|---|---|
| PubChem CID | 118650146 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | — |
| SMILES | C[C@]12C=C(C#N)C(=O)C3(CC=CC3)C1=CCC1[C@@H]2CC[C@@]2(C)[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C26H31NO3/c1-23-15-17(16-27)22(28)25(9-3-4-10-25)21(23)6-5-18-19(23)7-11-24(2)20(18)8-12-26(24)29-13-14-30-26/h3-4,6,15,18-20H,5,7-14H2,1-2H3/t18?,19-,20-,23+,24-/m0/s1 |
| InChIKey | QRTZNBMHFDJMAR-NTSYBMOASA-N |
| XLogP | 4.88 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|