C24H31NO2 — CID 70657812
(9S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxospiro[8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile (PubChem CID 70657812) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (9S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxospiro[8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile.
| Compound Name | (9S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxospiro[8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile |
|---|---|
| PubChem CID | 70657812 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (9S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxospiro[8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile |
| SMILES | CC12C=C(C#N)C(=O)C3(CCCC3)C1=CCC1[C@@H]2CCC2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C24H31NO2/c1-22-12-9-18-16(17(22)6-8-20(22)26)5-7-19-23(18,2)13-15(14-25)21(27)24(19)10-3-4-11-24/h7,13,16-18,20,26H,3-6,8-12H2,1-2H3/t16?,17-,18-,20-,22?,23?/m0/s1 |
| InChIKey | GBQYZEZUSITNSN-NHLKEHSWSA-N |
| XLogP | 4.72 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|