C25H35NO2 — CID 143902502
(10S)-17-hydroxy-10,13-dimethyl-3-oxospiro[8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile;methane (PubChem CID 143902502) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (10S)-17-hydroxy-10,13-dimethyl-3-oxospiro[8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile;methane.
| Compound Name | (10S)-17-hydroxy-10,13-dimethyl-3-oxospiro[8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile;methane |
|---|---|
| PubChem CID | 143902502 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (10S)-17-hydroxy-10,13-dimethyl-3-oxospiro[8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile;methane |
| SMILES | C.CC12CCC3C(CC=C4C5(CCCC5)C(=O)C(C#N)=C[C@@]43C)C1CCC2O |
| InChI | InChI=1S/C24H31NO2.CH4/c1-22-12-9-18-16(17(22)6-8-20(22)26)5-7-19-23(18,2)13-15(14-25)21(27)24(19)10-3-4-11-24;/h7,13,16-18,20,26H,3-6,8-12H2,1-2H3;1H4/t16?,17?,18?,20?,22?,23-;/m1./s1 |
| InChIKey | QBZYMELZJBBSBB-HFKZJIHWSA-N |
| XLogP | 5.36 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|