C24H29NO2 — CID 121360072
(9S,10S,13S,14S)-10,13-dimethyl-3,17-dioxospiro[7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile (PubChem CID 121360072) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (9S,10S,13S,14S)-10,13-dimethyl-3,17-dioxospiro[7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile.
| Compound Name | (9S,10S,13S,14S)-10,13-dimethyl-3,17-dioxospiro[7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile |
|---|---|
| PubChem CID | 121360072 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (9S,10S,13S,14S)-10,13-dimethyl-3,17-dioxospiro[7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-4,1'-cyclopentane]-2-carbonitrile |
| SMILES | C[C@]12C=C(C#N)C(=O)C3(CCCC3)C1=CCC1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H29NO2/c1-22-12-9-18-16(17(22)6-8-20(22)26)5-7-19-23(18,2)13-15(14-25)21(27)24(19)10-3-4-11-24/h7,13,16-18H,3-6,8-12H2,1-2H3/t16?,17-,18-,22-,23+/m0/s1 |
| InChIKey | GFXCMSMTUCNLAN-VXSYHQRCSA-N |
| XLogP | 4.93 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|