C26H33NO3 — CID 70657823
CID 70657823 (PubChem CID 70657823) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol.
| Compound Name | CID 70657823 |
|---|---|
| PubChem CID | 70657823 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | — |
| SMILES | CC12CC(C#N)=C(O)C3(CC=CC3)C1=CCC1[C@@H]2CCC2(C)[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C26H33NO3/c1-23-15-17(16-27)22(28)25(9-3-4-10-25)21(23)6-5-18-19(23)7-11-24(2)20(18)8-12-26(24)29-13-14-30-26/h3-4,6,18-20,28H,5,7-15H2,1-2H3/t18?,19-,20-,23?,24?/m0/s1 |
| InChIKey | UYWZRWKCCXOSOU-VVNPLHCPSA-N |
| XLogP | 5.58 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|