C27H37NO4 — CID 22823432
2-[(8S,9S,10R,13S,14S,17R)-17-(carboxymethyl)-2-cyano-4,4,10,13,17-pentamethyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid (PubChem CID 22823432) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S,17R)-17-(carboxymethyl)-2-cyano-4,4,10,13,17-pentamethyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid.
| Compound Name | 2-[(8S,9S,10R,13S,14S,17R)-17-(carboxymethyl)-2-cyano-4,4,10,13,17-pentamethyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid |
|---|---|
| PubChem CID | 22823432 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S,17R)-17-(carboxymethyl)-2-cyano-4,4,10,13,17-pentamethyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid |
| SMILES | CC1(C)C2=CC[C@@H]3[C@H](CC[C@@]4(C)[C@H]3CC[C@]4(C)CC(=O)O)[C@@]2(C)CC(C#N)=C1CC(=O)O |
| InChI | InChI=1S/C27H37NO4/c1-24(2)20(12-22(29)30)16(15-28)13-26(4)18-9-11-27(5)19(17(18)6-7-21(24)26)8-10-25(27,3)14-23(31)32/h7,17-19H,6,8-14H2,1-5H3,(H,29,30)(H,31,32)/t17-,18+,19+,25-,26-,27+/m1/s1 |
| InChIKey | VQLXBFHIYOWLCD-DODGFVBASA-N |
| XLogP | 5.97 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|