C22H29NO4P+ — CID 67830250
[(8R,9R,10R,13S,14S)-17-acetyloxy-17-cyano-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]-hydroxy-oxophosphanium (PubChem CID 67830250) has the molecular formula C22H29NO4P+ and a molecular weight of 402.45 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-17-acetyloxy-17-cyano-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]-hydroxy-oxophosphanium.
| Compound Name | [(8R,9R,10R,13S,14S)-17-acetyloxy-17-cyano-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67830250 |
| Molecular Formula | C22H29NO4P+ |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-17-acetyloxy-17-cyano-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]-hydroxy-oxophosphanium |
| SMILES | CC(=O)OC1(C#N)CC[C@H]2[C@@H]3CC=C4C=C([P+](=O)O)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H28NO4P/c1-14(24)27-22(13-23)11-8-19-17-5-4-15-12-16(28(25)26)6-9-20(15,2)18(17)7-10-21(19,22)3/h4,12,17-19H,5-11H2,1-3H3/p+1/t17-,18-,19+,20+,21+,22?/m1/s1 |
| InChIKey | VCLDVPQJLWSUCI-YTFGSMCFSA-O |
| XLogP | 5.00 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|