C25H32N2O6 — CID 101067720
[(8R,9S,10R,13S,14S,17S)-3,17-dicyano-3-methoxycarbonyloxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] methyl carbonate (PubChem CID 101067720) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-3,17-dicyano-3-methoxycarbonyloxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] methyl carbonate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-3,17-dicyano-3-methoxycarbonyloxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] methyl carbonate |
|---|---|
| PubChem CID | 101067720 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-3,17-dicyano-3-methoxycarbonyloxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] methyl carbonate |
| SMILES | COC(=O)OC1(C#N)C=C2CC[C@@H]3[C@H](CC[C@@]4(C)[C@H]3CC[C@]4(C#N)OC(=O)OC)[C@@]2(C)CC1 |
| InChI | InChI=1S/C25H32N2O6/c1-22-11-12-24(14-26,32-20(28)30-3)13-16(22)5-6-17-18(22)7-9-23(2)19(17)8-10-25(23,15-27)33-21(29)31-4/h13,17-19H,5-12H2,1-4H3/t17-,18+,19+,22+,23+,24?,25-/m1/s1 |
| InChIKey | CSERJCAPDXCEFU-SWRAXOJNSA-N |
| XLogP | 5.04 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|