C25H36O2 — CID 67673841
(8R,9S,10R,13S,14S,17R)-3-ethoxy-10,13-dimethyl-3'-methylidenespiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane] (PubChem CID 67673841) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-3-ethoxy-10,13-dimethyl-3'-methylidenespiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane].
| Compound Name | (8R,9S,10R,13S,14S,17R)-3-ethoxy-10,13-dimethyl-3'-methylidenespiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane] |
|---|---|
| PubChem CID | 67673841 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-3-ethoxy-10,13-dimethyl-3'-methylidenespiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane] |
| SMILES | C=C1CCO[C@]12CC[C@H]1[C@@H]3CC=C4C=C(OCC)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C25H36O2/c1-5-26-19-8-12-23(3)18(16-19)6-7-20-21(23)9-13-24(4)22(20)10-14-25(24)17(2)11-15-27-25/h6,16,20-22H,2,5,7-15H2,1,3-4H3/t20-,21+,22+,23+,24+,25-/m1/s1 |
| InChIKey | MYAMFFRLDWNDSY-WFGFEZODSA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|