C33H52O2Si — CID 71617064
(8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-16-methylidene-17-[2-tri(propan-2-yl)silylethynyl]-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 71617064) has the molecular formula C33H52O2Si and a molecular weight of 508.86 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-16-methylidene-17-[2-tri(propan-2-yl)silylethynyl]-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-16-methylidene-17-[2-tri(propan-2-yl)silylethynyl]-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 71617064 |
| Molecular Formula | C33H52O2Si |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.37 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-16-methylidene-17-[2-tri(propan-2-yl)silylethynyl]-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C=C1C[C@H]2[C@@H]3CC=C4C=C(OCC)CC[C@]4(C)[C@H]3CC[C@]2(C)[C@]1(O)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H52O2Si/c1-11-35-27-14-16-31(9)26(21-27)12-13-28-29(31)15-17-32(10)30(28)20-25(8)33(32,34)18-19-36(22(2)3,23(4)5)24(6)7/h12,21-24,28-30,34H,8,11,13-17,20H2,1-7,9-10H3/t28-,29+,30+,31+,32+,33+/m1/s1 |
| InChIKey | UDCVRANLIJFPDS-IZSHHDSDSA-N |
| XLogP | 8.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|