C24H32O2 — CID 142945945
(16R)-16-ethynyl-5-methoxy-2,17-dimethyltetracyclo[9.8.0.02,8.012,17]nonadeca-1(19),5,8-trien-16-ol (PubChem CID 142945945) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (16R)-16-ethynyl-5-methoxy-2,17-dimethyltetracyclo[9.8.0.02,8.012,17]nonadeca-1(19),5,8-trien-16-ol.
| Compound Name | (16R)-16-ethynyl-5-methoxy-2,17-dimethyltetracyclo[9.8.0.02,8.012,17]nonadeca-1(19),5,8-trien-16-ol |
|---|---|
| PubChem CID | 142945945 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (16R)-16-ethynyl-5-methoxy-2,17-dimethyltetracyclo[9.8.0.02,8.012,17]nonadeca-1(19),5,8-trien-16-ol |
| SMILES | C#C[C@]1(O)CCCC2C3CC=C4CC=C(OC)CCC4(C)C3=CCC21C |
| InChI | InChI=1S/C24H32O2/c1-5-24(25)14-6-7-21-19-11-9-17-8-10-18(26-4)12-15-22(17,2)20(19)13-16-23(21,24)3/h1,9-10,13,19,21,25H,6-8,11-12,14-16H2,2-4H3/t19?,21?,22?,23?,24-/m0/s1 |
| InChIKey | VXIZTQBWMRTJJG-QHUYACHGSA-N |
| XLogP | 5.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|