C22H29FO4 — CID 131854680
(6S,8S,10R,13S,14S,16S,17R)-16-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 131854680) has the molecular formula C22H29FO4 and a molecular weight of 376.47 g/mol. Its IUPAC name is (6S,8S,10R,13S,14S,16S,17R)-16-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,10R,13S,14S,16S,17R)-16-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 131854680 |
| Molecular Formula | C22H29FO4 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (6S,8S,10R,13S,14S,16S,17R)-16-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H]1C[C@@H]2C(=CC[C@@]3(C)[C@H]2C[C@H](F)[C@]3(O)C(=O)CO)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C22H29FO4/c1-12-8-14-15(20(2)6-4-13(25)9-16(12)20)5-7-21(3)17(14)10-18(23)22(21,27)19(26)11-24/h5,9,12,14,17-18,24,27H,4,6-8,10-11H2,1-3H3/t12-,14+,17-,18-,20+,21-,22-/m0/s1 |
| InChIKey | JDDNMGVKCMGSII-VOZLZOGUSA-N |
| XLogP | 2.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|