C27H38O6 — CID 56616977
[2-[(6S,8S,10R,13S,14S,16S,17S)-16-(methoxymethoxymethyl)-6,10,13-trimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 56616977) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is [2-[(6S,8S,10R,13S,14S,16S,17S)-16-(methoxymethoxymethyl)-6,10,13-trimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(6S,8S,10R,13S,14S,16S,17S)-16-(methoxymethoxymethyl)-6,10,13-trimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 56616977 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | [2-[(6S,8S,10R,13S,14S,16S,17S)-16-(methoxymethoxymethyl)-6,10,13-trimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | COCOC[C@H]1C[C@H]2[C@@H]3C[C@H](C)C4=CC(=O)CC[C@]4(C)C3=CC[C@]2(C)[C@H]1C(=O)COC(C)=O |
| InChI | InChI=1S/C27H38O6/c1-16-10-20-21(26(3)8-6-19(29)12-22(16)26)7-9-27(4)23(20)11-18(13-32-15-31-5)25(27)24(30)14-33-17(2)28/h7,12,16,18,20,23,25H,6,8-11,13-15H2,1-5H3/t16-,18+,20+,23-,25+,26+,27-/m0/s1 |
| InChIKey | JAGJSJGEYAUFTP-QOYWCYJRSA-N |
| XLogP | 4.28 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|