C26H32O6 — CID 12951814
[2-[(8S,10R,13S,14S,17R)-17-acetyloxy-10,13-dimethyl-6-methylidene-3-oxo-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 12951814) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is [2-[(8S,10R,13S,14S,17R)-17-acetyloxy-10,13-dimethyl-6-methylidene-3-oxo-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,10R,13S,14S,17R)-17-acetyloxy-10,13-dimethyl-6-methylidene-3-oxo-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 12951814 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [2-[(8S,10R,13S,14S,17R)-17-acetyloxy-10,13-dimethyl-6-methylidene-3-oxo-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | C=C1C[C@@H]2C(=CC[C@@]3(C)[C@H]2CC[C@]3(OC(C)=O)C(=O)COC(C)=O)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C26H32O6/c1-15-12-19-20(24(4)9-6-18(29)13-22(15)24)7-10-25(5)21(19)8-11-26(25,32-17(3)28)23(30)14-31-16(2)27/h7,13,19,21H,1,6,8-12,14H2,2-5H3/t19-,21+,24-,25+,26+/m1/s1 |
| InChIKey | BWEIOIHHZANQNT-ZLTUBLNUSA-N |
| XLogP | 4.04 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|