C24H28O3 — CID 70944096
(3S,5S,6S,15R,21R,23S)-6,15-dimethyl-7-oxaheptacyclo[12.9.0.02,11.03,5.06,11.015,20.021,23]tricosa-13,19-diene-8,18-dione (PubChem CID 70944096) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3S,5S,6S,15R,21R,23S)-6,15-dimethyl-7-oxaheptacyclo[12.9.0.02,11.03,5.06,11.015,20.021,23]tricosa-13,19-diene-8,18-dione.
| Compound Name | (3S,5S,6S,15R,21R,23S)-6,15-dimethyl-7-oxaheptacyclo[12.9.0.02,11.03,5.06,11.015,20.021,23]tricosa-13,19-diene-8,18-dione |
|---|---|
| PubChem CID | 70944096 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (3S,5S,6S,15R,21R,23S)-6,15-dimethyl-7-oxaheptacyclo[12.9.0.02,11.03,5.06,11.015,20.021,23]tricosa-13,19-diene-8,18-dione |
| SMILES | C[C@]12CCC(=O)C=C1[C@@H]1C[C@@H]1C1C2=CCC23CCC(=O)O[C@@]2(C)[C@H]2CC2C13 |
| InChI | InChI=1S/C24H28O3/c1-22-6-3-12(25)9-17(22)13-10-14(13)20-16(22)4-7-24-8-5-19(26)27-23(24,2)18-11-15(18)21(20)24/h4,9,13-15,18,20-21H,3,5-8,10-11H2,1-2H3/t13-,14+,15?,18+,20?,21?,22-,23+,24?/m1/s1 |
| InChIKey | OOKUCUPYCSRHFB-NWLIMLECSA-N |
| XLogP | 4.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|