C22H32FO7P — CID 134494000
[2-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-3,11-dihydroxy-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] dihydrogen phosphate (PubChem CID 134494000) has the molecular formula C22H32FO7P and a molecular weight of 458.46 g/mol. Its IUPAC name is [2-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-3,11-dihydroxy-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] dihydrogen phosphate.
| Compound Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-3,11-dihydroxy-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 134494000 |
| Molecular Formula | C22H32FO7P |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-3,11-dihydroxy-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] dihydrogen phosphate |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@H]1C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C22H32FO7P/c1-12-8-16-15-5-4-13-9-14(24)6-7-21(13,3)22(15,23)18(26)10-20(16,2)19(12)17(25)11-30-31(27,28)29/h6-7,9,12,14-16,18-19,24,26H,4-5,8,10-11H2,1-3H3,(H2,27,28,29)/t12-,14?,15+,16+,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | ZAJGGXJFFXQEBO-VNDKTKHQSA-N |
| XLogP | 2.69 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|