C24H32F2O4S — CID 91492763
S-(fluoromethyl) 9-ethyl-6-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate (PubChem CID 91492763) has the molecular formula C24H32F2O4S and a molecular weight of 454.58 g/mol. Its IUPAC name is S-(fluoromethyl) 9-ethyl-6-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate.
| Compound Name | S-(fluoromethyl) 9-ethyl-6-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate |
|---|---|
| PubChem CID | 91492763 |
| Molecular Formula | C24H32F2O4S |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | S-(fluoromethyl) 9-ethyl-6-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate |
| SMILES | CCC12C(O)CC3(C)C(CC(C)C3(O)C(=O)SCF)C1CC(F)C1=CC(=O)C=CC12C |
| InChI | InChI=1S/C24H32F2O4S/c1-5-23-16(10-18(26)17-9-14(27)6-7-21(17,23)3)15-8-13(2)24(30,20(29)31-12-25)22(15,4)11-19(23)28/h6-7,9,13,15-16,18-19,28,30H,5,8,10-12H2,1-4H3 |
| InChIKey | KHXKDRUWCPPEEF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|