C22H26F4O4S — CID 177323722
S-(fluoromethyl) (6S,9R,10S,11S,13S,14S,16R,17R)-1,6,9-trifluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate (PubChem CID 177323722) has the molecular formula C22H26F4O4S and a molecular weight of 462.51 g/mol. Its IUPAC name is S-(fluoromethyl) (6S,9R,10S,11S,13S,14S,16R,17R)-1,6,9-trifluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate.
| Compound Name | S-(fluoromethyl) (6S,9R,10S,11S,13S,14S,16R,17R)-1,6,9-trifluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate |
|---|---|
| PubChem CID | 177323722 |
| Molecular Formula | C22H26F4O4S |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | S-(fluoromethyl) (6S,9R,10S,11S,13S,14S,16R,17R)-1,6,9-trifluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate |
| SMILES | C[C@@H]1C[C@H]2C3C[C@H](F)C4=CC(=O)C=C(F)[C@@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)SCF |
| InChI | InChI=1S/C22H26F4O4S/c1-10-4-12-13-7-15(24)14-5-11(27)6-16(25)20(14,3)21(13,26)17(28)8-19(12,2)22(10,30)18(29)31-9-23/h5-6,10,12-13,15,17,28,30H,4,7-9H2,1-3H3/t10-,12+,13?,15+,17+,19+,20+,21+,22+/m1/s1 |
| InChIKey | DDZMNMAGJXDNLO-KDWZIXFKSA-N |
| XLogP | 3.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|