C23H29F3O4S — CID 59810121
S-(fluoromethyl) (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-17-hydroxy-11-methoxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate (PubChem CID 59810121) has the molecular formula C23H29F3O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is S-(fluoromethyl) (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-17-hydroxy-11-methoxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate.
| Compound Name | S-(fluoromethyl) (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-17-hydroxy-11-methoxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate |
|---|---|
| PubChem CID | 59810121 |
| Molecular Formula | C23H29F3O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | S-(fluoromethyl) (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-17-hydroxy-11-methoxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate |
| SMILES | CO[C@H]1C[C@@]2(C)[C@@H](C[C@@H](C)[C@]2(O)C(=O)SCF)[C@@H]2C[C@H](F)C3=CC(=O)C=C[C@]3(C)[C@@]12F |
| InChI | InChI=1S/C23H29F3O4S/c1-12-7-14-15-9-17(25)16-8-13(27)5-6-20(16,2)22(15,26)18(30-4)10-21(14,3)23(12,29)19(28)31-11-24/h5-6,8,12,14-15,17-18,29H,7,9-11H2,1-4H3/t12-,14+,15+,17+,18+,20+,21+,22+,23+/m1/s1 |
| InChIKey | IQPYKTIBSGKZPX-BSMQTTSKSA-N |
| XLogP | 4.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|