C21H27F2O4PS — CID 20739509
6,9-difluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-11-phosphanyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 20739509) has the molecular formula C21H27F2O4PS and a molecular weight of 444.48 g/mol. Its IUPAC name is 6,9-difluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-11-phosphanyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | 6,9-difluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-11-phosphanyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 20739509 |
| Molecular Formula | C21H27F2O4PS |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 6,9-difluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-11-phosphanyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(OP)CC2(C)C1(O)C(=O)S |
| InChI | InChI=1S/C21H27F2O4PS/c1-10-6-12-13-8-15(22)14-7-11(24)4-5-18(14,2)20(13,23)16(27-28)9-19(12,3)21(10,26)17(25)29/h4-5,7,10,12-13,15-16,26H,6,8-9,28H2,1-3H3,(H,25,29) |
| InChIKey | FEGUBUQVKJLDSB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|