C26H30F2O6S — CID 163427501
(1R,2S,5R)-3-[(4S,8aS)-4-fluoro-8a-methyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-fluoro-2-hydroxyethyl)-1-(furan-2-carbonyloxy)-2,5-dimethylcyclopentane-1-carbothioic S-acid (PubChem CID 163427501) has the molecular formula C26H30F2O6S and a molecular weight of 508.58 g/mol. Its IUPAC name is (1R,2S,5R)-3-[(4S,8aS)-4-fluoro-8a-methyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-fluoro-2-hydroxyethyl)-1-(furan-2-carbonyloxy)-2,5-dimethylcyclopentane-1-carbothioic S-acid.
| Compound Name | (1R,2S,5R)-3-[(4S,8aS)-4-fluoro-8a-methyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-fluoro-2-hydroxyethyl)-1-(furan-2-carbonyloxy)-2,5-dimethylcyclopentane-1-carbothioic S-acid |
|---|---|
| PubChem CID | 163427501 |
| Molecular Formula | C26H30F2O6S |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (1R,2S,5R)-3-[(4S,8aS)-4-fluoro-8a-methyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-fluoro-2-hydroxyethyl)-1-(furan-2-carbonyloxy)-2,5-dimethylcyclopentane-1-carbothioic S-acid |
| SMILES | C[C@@H]1CC(C2C[C@H](F)C3=CC(=O)C=C[C@]3(C)C2)[C@](C)(CC(O)F)[C@@]1(OC(=O)c1ccco1)C(=O)S |
| InChI | InChI=1S/C26H30F2O6S/c1-14-9-17(15-10-19(27)18-11-16(29)6-7-24(18,2)12-15)25(3,13-21(28)30)26(14,23(32)35)34-22(31)20-5-4-8-33-20/h4-8,11,14-15,17,19,21,30H,9-10,12-13H2,1-3H3,(H,32,35)/t14-,15?,17?,19+,21?,24-,25+,26+/m1/s1 |
| InChIKey | ANUADKKMYLBFAF-ANSNTFECSA-N |
| XLogP | 4.79 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|