C27H34F2O6S — CID 142272047
[(5R)-3-[(4S)-4-fluoro-8a-methyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-fluoro-2-hydroxyethyl)-1-formyl-2,5-dimethylcyclopentyl] furan-2-carboxylate;methanethiol (PubChem CID 142272047) has the molecular formula C27H34F2O6S and a molecular weight of 524.63 g/mol. Its IUPAC name is [(5R)-3-[(4S)-4-fluoro-8a-methyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-fluoro-2-hydroxyethyl)-1-formyl-2,5-dimethylcyclopentyl] furan-2-carboxylate;methanethiol.
| Compound Name | [(5R)-3-[(4S)-4-fluoro-8a-methyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-fluoro-2-hydroxyethyl)-1-formyl-2,5-dimethylcyclopentyl] furan-2-carboxylate;methanethiol |
|---|---|
| PubChem CID | 142272047 |
| Molecular Formula | C27H34F2O6S |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | [(5R)-3-[(4S)-4-fluoro-8a-methyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-fluoro-2-hydroxyethyl)-1-formyl-2,5-dimethylcyclopentyl] furan-2-carboxylate;methanethiol |
| SMILES | CS.C[C@@H]1CC(C2C[C@H](F)C3=CC(=O)C=CC3(C)C2)C(C)(CC(O)F)C1(C=O)OC(=O)c1ccco1 |
| InChI | InChI=1S/C26H30F2O6.CH4S/c1-15-9-18(16-10-20(27)19-11-17(30)6-7-24(19,2)12-16)25(3,13-22(28)31)26(15,14-29)34-23(32)21-5-4-8-33-21;1-2/h4-8,11,14-16,18,20,22,31H,9-10,12-13H2,1-3H3;2H,1H3/t15-,16?,18?,20+,22?,24?,25?,26?;/m1./s1 |
| InChIKey | NDNZBTWQNMTWNJ-BVOKMMMCSA-N |
| XLogP | 5.08 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|