C21H26O5 — CID 134575503
(1R,2S,5R,7R,9S,10S,11R,17S)-9-hydroxy-5-(2-hydroxyacetyl)-11,17-dimethyl-6-oxapentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one (PubChem CID 134575503) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (1R,2S,5R,7R,9S,10S,11R,17S)-9-hydroxy-5-(2-hydroxyacetyl)-11,17-dimethyl-6-oxapentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one.
| Compound Name | (1R,2S,5R,7R,9S,10S,11R,17S)-9-hydroxy-5-(2-hydroxyacetyl)-11,17-dimethyl-6-oxapentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one |
|---|---|
| PubChem CID | 134575503 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1R,2S,5R,7R,9S,10S,11R,17S)-9-hydroxy-5-(2-hydroxyacetyl)-11,17-dimethyl-6-oxapentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one |
| SMILES | C[C@H]1C[C@@H]2[C@H]([C@@H](O)C[C@]34O[C@]3(C(=O)CO)CC[C@@H]24)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C21H26O5/c1-11-7-13-14-4-6-20(17(25)10-22)21(14,26-20)9-16(24)18(13)19(2)5-3-12(23)8-15(11)19/h3,5,8,11,13-14,16,18,22,24H,4,6-7,9-10H2,1-2H3/t11-,13-,14-,16-,18+,19-,20-,21+/m0/s1 |
| InChIKey | JETPXCQPFILEIY-QNWIYUEGSA-N |
| XLogP | 1.57 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|