C29H34O6 — CID 70468907
[(8S,9S,10R,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 70468907) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 70468907 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CC1C[C@@H]2[C@H](C(O)C[C@@]3(C)[C@H]2CC[C@]3(OC(=O)c2ccccc2)C(=O)CO)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C29H34O6/c1-17-13-20-21-10-12-29(24(33)16-30,35-26(34)18-7-5-4-6-8-18)28(21,3)15-23(32)25(20)27(2)11-9-19(31)14-22(17)27/h4-9,11,14,17,20-21,23,25,30,32H,10,12-13,15-16H2,1-3H3/t17?,20-,21-,23?,25+,27-,28-,29-/m0/s1 |
| InChIKey | CDWNMQSZLYVEKK-IOMKFFRUSA-N |
| XLogP | 3.67 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |