C28H29ClO6 — CID 70550264
[(8S,9S,10R,11S,13S,14S,17S)-6-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 70550264) has the molecular formula C28H29ClO6 and a molecular weight of 496.99 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,17S)-6-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(8S,9S,10R,11S,13S,14S,17S)-6-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 70550264 |
| Molecular Formula | C28H29ClO6 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,17S)-6-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | C[C@]12C=CC(=O)C=C1C(Cl)=C[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@@]2(OC(=O)c1ccccc1)C(=O)CO |
| InChI | InChI=1S/C28H29ClO6/c1-26-10-8-17(31)12-20(26)21(29)13-18-19-9-11-28(23(33)15-30,27(19,2)14-22(32)24(18)26)35-25(34)16-6-4-3-5-7-16/h3-8,10,12-13,18-19,22,24,30,32H,9,11,14-15H2,1-2H3/t18-,19-,22-,24+,26-,27-,28+/m0/s1 |
| InChIKey | BAHKBWKDNDAGAA-ZIHWKPOJSA-N |
| XLogP | 3.76 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |