C30H44O6S — CID 70476301
[(8S,9S,10R,13S,14S,17R)-11-hydroxy-6,10,13-trimethyl-3-oxo-17-(2-pentoxyacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 2-methylsulfanylacetate (PubChem CID 70476301) has the molecular formula C30H44O6S and a molecular weight of 532.74 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-11-hydroxy-6,10,13-trimethyl-3-oxo-17-(2-pentoxyacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 2-methylsulfanylacetate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-11-hydroxy-6,10,13-trimethyl-3-oxo-17-(2-pentoxyacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 2-methylsulfanylacetate |
|---|---|
| PubChem CID | 70476301 |
| Molecular Formula | C30H44O6S |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-11-hydroxy-6,10,13-trimethyl-3-oxo-17-(2-pentoxyacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 2-methylsulfanylacetate |
| SMILES | CCCCCOCC(=O)[C@@]1(OC(=O)CSC)CC[C@H]2[C@@H]3CC(C)C4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C30H44O6S/c1-6-7-8-13-35-17-25(33)30(36-26(34)18-37-5)12-10-22-21-14-19(2)23-15-20(31)9-11-28(23,3)27(21)24(32)16-29(22,30)4/h9,11,15,19,21-22,24,27,32H,6-8,10,12-14,16-18H2,1-5H3/t19?,21-,22-,24?,27+,28-,29-,30-/m0/s1 |
| InChIKey | RVACWMNKRJAFHR-LPXAEGKMSA-N |
| XLogP | 4.93 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|