C34H54ClNO7 — CID 123844716
N-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethyl]-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 123844716) has the molecular formula C34H54ClNO7 and a molecular weight of 624.26 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethyl]-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | N-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethyl]-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 123844716 |
| Molecular Formula | C34H54ClNO7 |
| Molecular Weight | 624.26 g/mol |
| Exact Mass | 623.36 |
| IUPAC Name | N-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethyl]-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C(C(=O)NCCOCCOCCOCCOCCCCCCCl)CCC12 |
| InChI | InChI=1S/C34H54ClNO7/c1-33-12-11-26(37)23-25(33)7-8-27-28-9-10-29(34(28,2)24-30(38)31(27)33)32(39)36-14-16-41-18-20-43-22-21-42-19-17-40-15-6-4-3-5-13-35/h11-12,23,27-31,38H,3-10,13-22,24H2,1-2H3,(H,36,39) |
| InChIKey | AJQKLPJRELWVLA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.26 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|