C23H35ClO3 — CID 69349912
(8S,9S,10S,11S,13S,14S)-1-(chloromethyl)-11-(1-hydroxypropoxy)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 69349912) has the molecular formula C23H35ClO3 and a molecular weight of 394.98 g/mol. Its IUPAC name is (8S,9S,10S,11S,13S,14S)-1-(chloromethyl)-11-(1-hydroxypropoxy)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10S,11S,13S,14S)-1-(chloromethyl)-11-(1-hydroxypropoxy)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 69349912 |
| Molecular Formula | C23H35ClO3 |
| Molecular Weight | 394.98 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (8S,9S,10S,11S,13S,14S)-1-(chloromethyl)-11-(1-hydroxypropoxy)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCC(O)O[C@H]1C[C@]2(C)CCC[C@H]2[C@@H]2CCC3=CC(=O)CC(CCl)[C@]3(C)[C@H]21 |
| InChI | InChI=1S/C23H35ClO3/c1-4-20(26)27-19-12-22(2)9-5-6-18(22)17-8-7-14-10-16(25)11-15(13-24)23(14,3)21(17)19/h10,15,17-21,26H,4-9,11-13H2,1-3H3/t15?,17-,18-,19-,20?,21+,22-,23+/m0/s1 |
| InChIKey | VENLKCDSEQMJNK-YBUVHMEESA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.98 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|