C31H38F3NO4 — CID 175255922
[[(8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl] propanoate (PubChem CID 175255922) has the molecular formula C31H38F3NO4 and a molecular weight of 545.64 g/mol. Its IUPAC name is [[(8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl] propanoate.
| Compound Name | [[(8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl] propanoate |
|---|---|
| PubChem CID | 175255922 |
| Molecular Formula | C31H38F3NO4 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | [[(8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl] propanoate |
| SMILES | CCC(=O)OC(=O)N(Cc1cccc(C(F)(F)F)c1)C1CC(=O)C=C2CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C31H38F3NO4/c1-4-27(37)39-28(38)35(18-19-7-5-8-21(15-19)31(32,33)34)26-17-22(36)16-20-10-11-23-24-9-6-13-29(24,2)14-12-25(23)30(20,26)3/h5,7-8,15-16,23-26H,4,6,9-14,17-18H2,1-3H3/t23-,24-,25-,26?,29-,30-/m0/s1 |
| InChIKey | AHHNMJYTSLYEGW-ALPGBOSFSA-N |
| XLogP | 7.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|