C27H35F3NO+ — CID 87801034
(3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-6-[[3-(trifluoromethyl)phenyl]methyl]-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-6-ium-7-one (PubChem CID 87801034) has the molecular formula C27H35F3NO+ and a molecular weight of 446.58 g/mol. Its IUPAC name is (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-6-[[3-(trifluoromethyl)phenyl]methyl]-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-6-ium-7-one.
| Compound Name | (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-6-[[3-(trifluoromethyl)phenyl]methyl]-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-6-ium-7-one |
|---|---|
| PubChem CID | 87801034 |
| Molecular Formula | C27H35F3NO+ |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-6-[[3-(trifluoromethyl)phenyl]methyl]-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-6-ium-7-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@@H]3[C@](C)(C=CC(=O)[N+]3(C)Cc3cccc(C(F)(F)F)c3)[C@H]1CC2 |
| InChI | InChI=1S/C27H35F3NO/c1-25-13-5-8-21(25)20-9-10-23-26(2,22(20)11-14-25)15-12-24(32)31(23,3)17-18-6-4-7-19(16-18)27(28,29)30/h4,6-7,12,15-16,20-23H,5,8-11,13-14,17H2,1-3H3/q+1/t20-,21-,22-,23+,25-,26+,31?/m0/s1 |
| InChIKey | GVXHFIKHYXPKQS-UGFRDDBSSA-N |
| XLogP | 6.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|